CAS 220598-36-7 is the registry number for tert-Butyl 4-(((methylsulfonyl)oxy)methyl)-2-azabicyclo(2.1.1)hexane-2-carboxylate, 97%. Offered by: AmBeed. Available pack sizes: 5g.
Tert-butyl 4-(methylsulfonyloxymethyl)-2-azabicyclo[2.1.1]hexane-2-carboxylate (CAS 220598-36-7) is a chemical compound with the molecular formula C12H21NO5S and a molecular weight of 291.37 g/mol. IUPAC name: tert-butyl 4-(methylsulfonyloxymethyl)-2-azabicyclo[2.1.1]hexane-2-carboxylate. InChIKey: SFAGWQPBNNQUJG-UHFFFAOYSA-N.
| Molecular formula | C12H21NO5S |
|---|---|
| Molecular weight | 291.37 g/mol |
| IUPAC name | tert-butyl 4-(methylsulfonyloxymethyl)-2-azabicyclo[2.1.1]hexane-2-carboxylate |
| InChIKey | SFAGWQPBNNQUJG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(CC1C2)COS(=O)(=O)C |
Computed by PubChem (NCBI)