CAS 887352-13-8 is the registry number for 3-((Methoxysulfonyl)methyl)-2,2,5,5-tetramethyl-2,5-dihydro-1H-pyrrol-1-yl acetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[2,2,5,5-tetramethyl-3-(methylsulfonyloxymethyl)pyrrol-1-yl] acetate (CAS 887352-13-8) is a chemical compound with the molecular formula C12H21NO5S and a molecular weight of 291.37 g/mol. IUPAC name: [2,2,5,5-tetramethyl-3-(methylsulfonyloxymethyl)pyrrol-1-yl] acetate. InChIKey: IAXVRAGHABYUKD-UHFFFAOYSA-N.
| Molecular formula | C12H21NO5S |
|---|---|
| Molecular weight | 291.37 g/mol |
| IUPAC name | [2,2,5,5-tetramethyl-3-(methylsulfonyloxymethyl)pyrrol-1-yl] acetate |
| InChIKey | IAXVRAGHABYUKD-UHFFFAOYSA-N |
| SMILES | CC(=O)ON1C(C=C(C1(C)C)COS(=O)(=O)C)(C)C |
Computed by PubChem (NCBI)