Products 1373043-45-8
CAS 1373043-45-8 appears in our catalog under these names: (3-(1-Isopropyl-1H-pyrazol-4-yl)phenyl)boronic acid, 95%, 3-(1-Isopropyl-4-pyrazolyl)phenylboronic Acid, ≥95%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg.
[3-(1-propan-2-ylpyrazol-4-yl)phenyl]boronic acid (CAS 1373043-45-8) is a chemical compound with the molecular formula C12H15BN2O2 and a molecular weight of 230.07 g/mol. IUPAC name: [3-(1-propan-2-ylpyrazol-4-yl)phenyl]boronic acid. InChIKey: WZSNTMSJDVPRAR-UHFFFAOYSA-N.
| Molecular formula | C12H15BN2O2 |
|---|---|
| Molecular weight | 230.07 g/mol |
| IUPAC name | [3-(1-propan-2-ylpyrazol-4-yl)phenyl]boronic acid |
| InChIKey | WZSNTMSJDVPRAR-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C2=CN(N=C2)C(C)C)(O)O |
Computed by PubChem (NCBI)