CAS 1373223-75-6 appears in our catalog under these names: (5-(Trifluoromethyl)furan-2-yl)methanamine hydrochloride, 97%, (5-(Trifluoromethyl)furan-2-yl)methylamine hydrochloride, (5-(Trifluoromethyl)furan-2-yl)methanamine hydrochloride, 95%, 95%, (5-(Trifluoromethyl)furan-2-yl)methanamine hydrochloride, 95%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 1g, 50mg, 250mg, 500mg, 10g.
[5-(trifluoromethyl)furan-2-yl]methanamine;hydrochloride (CAS 1373223-75-6) is a chemical compound with the molecular formula C6H7ClF3NO and a molecular weight of 201.57 g/mol. IUPAC name: [5-(trifluoromethyl)furan-2-yl]methanamine;hydrochloride. InChIKey: ZKZRRMAYTDPNCH-UHFFFAOYSA-N.
| Molecular formula | C6H7ClF3NO |
|---|---|
| Molecular weight | 201.57 g/mol |
| IUPAC name | [5-(trifluoromethyl)furan-2-yl]methanamine;hydrochloride |
| InChIKey | ZKZRRMAYTDPNCH-UHFFFAOYSA-N |
| SMILES | C1=C(OC(=C1)C(F)(F)F)CN.Cl |
Computed by PubChem (NCBI)