CAS 65686-91-1 appears in our catalog under these names: 2,2,2–Trifluoro–1–(furan–2–yl)ethan–1–amine hydrochloride, 2,2,2-Trifluoro-1-(furan-2-yl)ethan-1-amine hydrochloride, 2,2,2-Trifluoro-1-(furan-2-yl)ethan-1-amine hydrochloride, 95%, 2,2,2-Trifluoro-1-(furan-2-yl)ethan-1-amine hydrochloride, 95%, 95%. Offered by: GLPBio, Biosynth, Combi-blocks, Fluorochem, Chemat. Available pack sizes: 100mg, 1g, 250mg, 2,5g, 50mg.
2,2,2-trifluoro-1-(furan-2-yl)ethanamine;hydrochloride (CAS 65686-91-1) is a chemical compound with the molecular formula C6H7ClF3NO and a molecular weight of 201.57 g/mol. IUPAC name: 2,2,2-trifluoro-1-(furan-2-yl)ethanamine;hydrochloride. InChIKey: DISUAXNVCVWUGH-UHFFFAOYSA-N.
| Molecular formula | C6H7ClF3NO |
|---|---|
| Molecular weight | 201.57 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-(furan-2-yl)ethanamine;hydrochloride |
| InChIKey | DISUAXNVCVWUGH-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C(C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)