CAS 1373232-44-0 is the registry number for Methyl 4-(3-aminophenyl)-2-fluorobenzoate hydrochloride, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Methyl 4-(3-aminophenyl)-2-fluorobenzoate;hydrochloride (CAS 1373232-44-0) is a chemical compound with the molecular formula C14H13ClFNO2 and a molecular weight of 281.71 g/mol. IUPAC name: methyl 4-(3-aminophenyl)-2-fluorobenzoate;hydrochloride. InChIKey: XGCWMHLJNLWDHO-UHFFFAOYSA-N.
| Molecular formula | C14H13ClFNO2 |
|---|---|
| Molecular weight | 281.71 g/mol |
| IUPAC name | methyl 4-(3-aminophenyl)-2-fluorobenzoate;hydrochloride |
| InChIKey | XGCWMHLJNLWDHO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)C2=CC(=CC=C2)N)F.Cl |
Computed by PubChem (NCBI)