Products 1373232-44-0

CAS 1373232-44-0 is the registry number for Methyl 4-(3-aminophenyl)-2-fluorobenzoate hydrochloride, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

Methyl 4-(3-aminophenyl)-2-fluorobenzoate;hydrochloride (CAS 1373232-44-0) is a chemical compound with the molecular formula C14H13ClFNO2 and a molecular weight of 281.71 g/mol. IUPAC name: methyl 4-(3-aminophenyl)-2-fluorobenzoate;hydrochloride. InChIKey: XGCWMHLJNLWDHO-UHFFFAOYSA-N.

Identity
Molecular formulaC14H13ClFNO2
Molecular weight281.71 g/mol
IUPAC namemethyl 4-(3-aminophenyl)-2-fluorobenzoate;hydrochloride
InChIKeyXGCWMHLJNLWDHO-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(C=C(C=C1)C2=CC(=CC=C2)N)F.Cl

Computed by PubChem (NCBI)