CAS 1909326-50-6 appears in our catalog under these names: benzyl 2-amino-3-fluorobenzoate hydrochloride, 95%, Benzyl 2-amino-3-fluorobenzoate hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
Benzyl 2-amino-3-fluorobenzoate;hydrochloride (CAS 1909326-50-6) is a chemical compound with the molecular formula C14H13ClFNO2 and a molecular weight of 281.71 g/mol. IUPAC name: benzyl 2-amino-3-fluorobenzoate;hydrochloride. InChIKey: NYFORKXZQZEZCZ-UHFFFAOYSA-N.
| Molecular formula | C14H13ClFNO2 |
|---|---|
| Molecular weight | 281.71 g/mol |
| IUPAC name | benzyl 2-amino-3-fluorobenzoate;hydrochloride |
| InChIKey | NYFORKXZQZEZCZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)C2=C(C(=CC=C2)F)N.Cl |
Computed by PubChem (NCBI)