CAS 1373232-98-4 is the registry number for Tert-butyl 4-(5-aminoquinolin-8-yl)piperazine-1-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Tert-butyl 4-(5-aminoquinolin-8-yl)piperazine-1-carboxylate (CAS 1373232-98-4) is a chemical compound with the molecular formula C18H24N4O2 and a molecular weight of 328.4 g/mol. IUPAC name: tert-butyl 4-(5-aminoquinolin-8-yl)piperazine-1-carboxylate. InChIKey: QHYNCBGTMCIGAP-UHFFFAOYSA-N.
| Molecular formula | C18H24N4O2 |
|---|---|
| Molecular weight | 328.4 g/mol |
| IUPAC name | tert-butyl 4-(5-aminoquinolin-8-yl)piperazine-1-carboxylate |
| InChIKey | QHYNCBGTMCIGAP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C2=C3C(=C(C=C2)N)C=CC=N3 |
Computed by PubChem (NCBI)