Products 160177-68-4
CAS 160177-68-4 is the registry number for Granisetron N-Oxide. Offered by: Mikromol, LoGiCal. Available pack sizes: 50mg, 10mg.
1-methyl-N-[(1S,5R)-9-methyl-9-oxido-9-azoniabicyclo[3.3.1]nonan-3-yl]indazole-3-carboxamide (CAS 160177-68-4) is a chemical compound with the molecular formula C18H24N4O2 and a molecular weight of 328.4 g/mol. IUPAC name: 1-methyl-N-[(1S,5R)-9-methyl-9-oxido-9-azoniabicyclo[3.3.1]nonan-3-yl]indazole-3-carboxamide. InChIKey: UMBTYYGXIVUPCY-NFFIMNGOSA-N.
| Molecular formula | C18H24N4O2 |
|---|---|
| Molecular weight | 328.4 g/mol |
| IUPAC name | 1-methyl-N-[(1S,5R)-9-methyl-9-oxido-9-azoniabicyclo[3.3.1]nonan-3-yl]indazole-3-carboxamide |
| InChIKey | UMBTYYGXIVUPCY-NFFIMNGOSA-N |
| SMILES | CN1C2=CC=CC=C2C(=N1)C(=O)NC3C[C@H]4CCC[C@@H](C3)[N+]4(C)[O-] |
Computed by PubChem (NCBI)
Synonyms:
Granisetron N-Oxide, Granisetron Impurity 41