Products 1373311-69-3
CAS 1373311-69-3 is the registry number for Antifungal agent 113. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-(4-propan-2-ylphenyl)-3-(2,3,4-trihydroxyphenyl)-2-benzofuran-1-one (CAS 1373311-69-3) is a chemical compound with the molecular formula C23H20O5 and a molecular weight of 376.4 g/mol. IUPAC name: 3-(4-propan-2-ylphenyl)-3-(2,3,4-trihydroxyphenyl)-2-benzofuran-1-one. InChIKey: GCNFYYVRDJMNGM-UHFFFAOYSA-N.
| Molecular formula | C23H20O5 |
|---|---|
| Molecular weight | 376.4 g/mol |
| IUPAC name | 3-(4-propan-2-ylphenyl)-3-(2,3,4-trihydroxyphenyl)-2-benzofuran-1-one |
| InChIKey | GCNFYYVRDJMNGM-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)C2(C3=CC=CC=C3C(=O)O2)C4=C(C(=C(C=C4)O)O)O |
Computed by PubChem (NCBI)