Products 1613312-78-9

CAS 1613312-78-9 is the registry number for 3-(3,4-Bis(benzyloxy)phenyl)-2-oxopropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-[3,4-bis(phenylmethoxy)phenyl]-2-oxopropanoic acid (CAS 1613312-78-9) is a chemical compound with the molecular formula C23H20O5 and a molecular weight of 376.4 g/mol. IUPAC name: 3-[3,4-bis(phenylmethoxy)phenyl]-2-oxopropanoic acid. InChIKey: PFQKXFOPGAFQJK-UHFFFAOYSA-N.

Identity
Molecular formulaC23H20O5
Molecular weight376.4 g/mol
IUPAC name3-[3,4-bis(phenylmethoxy)phenyl]-2-oxopropanoic acid
InChIKeyPFQKXFOPGAFQJK-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)COC2=C(C=C(C=C2)CC(=O)C(=O)O)OCC3=CC=CC=C3

Computed by PubChem (NCBI)