CAS 1373321-04-0 appears in our catalog under these names: Dapagliflozin Impurity 11, Dapagliflozin Impurity 43, Dapagliflozin alfa-Isomer, 1R-Dapagliflozin, >95% (HPLC), Dapagliflozin Impurity 30. Offered by: Chemat Brand, TRC, Biosynth, Ambeed, Chemat. Available pack sizes: on request, 10mg, 2,5mg, 5mg, 2mg, 50mg, 25mg, 100mg.
(2R,3R,4R,5S,6R)-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (CAS 1373321-04-0) is a chemical compound with the molecular formula C21H25ClO6 and a molecular weight of 408.9 g/mol. IUPAC name: (2R,3R,4R,5S,6R)-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol. InChIKey: JVHXJTBJCFBINQ-YMQHIKHWSA-N.
| Molecular formula | C21H25ClO6 |
|---|---|
| Molecular weight | 408.9 g/mol |
| IUPAC name | (2R,3R,4R,5S,6R)-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| InChIKey | JVHXJTBJCFBINQ-YMQHIKHWSA-N |
| SMILES | CCOC1=CC=C(C=C1)CC2=C(C=CC(=C2)[C@@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)Cl |
Computed by PubChem (NCBI)