CAS 2133407-75-5 appears in our catalog under these names: Dapagliflozin Impurity 30, Dapagliflozin Impurity 23, Dapagliflozin Impurity 24, Dapagliflozin C2 Epimer, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg.
(2S,3S,4R,5S,6R)-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (CAS 2133407-75-5) is a chemical compound with the molecular formula C21H25ClO6 and a molecular weight of 408.9 g/mol. IUPAC name: (2S,3S,4R,5S,6R)-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol. InChIKey: JVHXJTBJCFBINQ-MJCUULBUSA-N.
| Molecular formula | C21H25ClO6 |
|---|---|
| Molecular weight | 408.9 g/mol |
| IUPAC name | (2S,3S,4R,5S,6R)-2-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| InChIKey | JVHXJTBJCFBINQ-MJCUULBUSA-N |
| SMILES | CCOC1=CC=C(C=C1)CC2=C(C=CC(=C2)[C@H]3[C@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)Cl |
Computed by PubChem (NCBI)