CAS 13735-13-2 appears in our catalog under these names: 6–Bromothiochroman–4–one, 6-Bromothiochroman-4-one, 95% , 6-Bromothiochroman-4-one 95%, 6-Bromothiochroman-4-one, 98%, 98%, 6-Bromothiochroman-4-one, 98%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 5g, 250mg, 25g, 100mg.
6-bromo-2,3-dihydrothiochromen-4-one (CAS 13735-13-2) is a chemical compound with the molecular formula C9H7BrOS and a molecular weight of 243.12 g/mol. IUPAC name: 6-bromo-2,3-dihydrothiochromen-4-one. InChIKey: SBNPYDJTVGRDAA-UHFFFAOYSA-N.
| Molecular formula | C9H7BrOS |
|---|---|
| Molecular weight | 243.12 g/mol |
| IUPAC name | 6-bromo-2,3-dihydrothiochromen-4-one |
| InChIKey | SBNPYDJTVGRDAA-UHFFFAOYSA-N |
| SMILES | C1CSC2=C(C1=O)C=C(C=C2)Br |
Computed by PubChem (NCBI)