CAS 880553-98-0 appears in our catalog under these names: 6-Bromo-3,4-dihydro-1H-2-benzothiopyran-4-one, 95%, 6-Bromo-3,4-dihydro-1H-2-benzothiopyran-4-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
6-bromo-1H-isothiochromen-4-one (CAS 880553-98-0) is a chemical compound with the molecular formula C9H7BrOS and a molecular weight of 243.12 g/mol. IUPAC name: 6-bromo-1H-isothiochromen-4-one. InChIKey: HPIUPYXHSHXTAW-UHFFFAOYSA-N.
| Molecular formula | C9H7BrOS |
|---|---|
| Molecular weight | 243.12 g/mol |
| IUPAC name | 6-bromo-1H-isothiochromen-4-one |
| InChIKey | HPIUPYXHSHXTAW-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=C(C=C2)Br)C(=O)CS1 |
Computed by PubChem (NCBI)