CAS 13736-22-6 is the registry number for Sodium 4-formylbenzenesulfonate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg, 100mg.
Sodium 4-formylbenzenesulfonate (CAS 13736-22-6) is a chemical compound with the molecular formula C7H5NaO4S and a molecular weight of 208.17 g/mol. IUPAC name: sodium 4-formylbenzenesulfonate. InChIKey: FZPPRCKGVCCJSG-UHFFFAOYSA-M.
| Molecular formula | C7H5NaO4S |
|---|---|
| Molecular weight | 208.17 g/mol |
| IUPAC name | sodium 4-formylbenzenesulfonate |
| InChIKey | FZPPRCKGVCCJSG-UHFFFAOYSA-M |
| SMILES | C1=CC(=CC=C1C=O)S(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)