CAS 253594-68-2 appears in our catalog under these names: Sodium 2H-1,3-benzodioxole-5-sulfinate 95%, Sodium 2H-1,3-benzodioxole-5-sulfinate, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
Sodium 1,3-benzodioxole-5-sulfinate (CAS 253594-68-2) is a chemical compound with the molecular formula C7H5NaO4S and a molecular weight of 208.17 g/mol. IUPAC name: sodium 1,3-benzodioxole-5-sulfinate. InChIKey: XFZNCFPAQMJVPD-UHFFFAOYSA-M.
| Molecular formula | C7H5NaO4S |
|---|---|
| Molecular weight | 208.17 g/mol |
| IUPAC name | sodium 1,3-benzodioxole-5-sulfinate |
| InChIKey | XFZNCFPAQMJVPD-UHFFFAOYSA-M |
| SMILES | C1OC2=C(O1)C=C(C=C2)S(=O)[O-].[Na+] |
Computed by PubChem (NCBI)