CAS 137371-96-1 is the registry number for Bis(methylsulfinylethyl)sulfone. Offered by: TRC. Available pack sizes: 10mg.
1-methylsulfinyl-2-(2-methylsulfinylethylsulfonyl)ethane (CAS 137371-96-1) is a chemical compound with the molecular formula C6H14O4S3 and a molecular weight of 246.4 g/mol. IUPAC name: 1-methylsulfinyl-2-(2-methylsulfinylethylsulfonyl)ethane. InChIKey: CGWQFULXJFXDII-UHFFFAOYSA-N.
| Molecular formula | C6H14O4S3 |
|---|---|
| Molecular weight | 246.4 g/mol |
| IUPAC name | 1-methylsulfinyl-2-(2-methylsulfinylethylsulfonyl)ethane |
| InChIKey | CGWQFULXJFXDII-UHFFFAOYSA-N |
| SMILES | CS(=O)CCS(=O)(=O)CCS(=O)C |
Computed by PubChem (NCBI)