CAS 672310-55-3 is the registry number for Bis(methylsulfinylethyl)sulfone-13C4. Offered by: TRC, MedChemExpress. Available pack sizes: 1mg, 1 mg.
1-methylsulfinyl-2-(2-methylsulfinyl(1,2-13C2)ethylsulfonyl)(1,2-13C2)ethane (CAS 672310-55-3) is a chemical compound with the molecular formula C6H14O4S3 and a molecular weight of 250.3 g/mol. IUPAC name: 1-methylsulfinyl-2-(2-methylsulfinyl(1,2-13C2)ethylsulfonyl)(1,2-13C2)ethane. InChIKey: CGWQFULXJFXDII-PQVJJBODSA-N.
| Molecular formula | C6H14O4S3 |
|---|---|
| Molecular weight | 250.3 g/mol |
| IUPAC name | 1-methylsulfinyl-2-(2-methylsulfinyl(1,2-13C2)ethylsulfonyl)(1,2-13C2)ethane |
| InChIKey | CGWQFULXJFXDII-PQVJJBODSA-N |
| SMILES | CS(=O)[13CH2][13CH2]S(=O)(=O)[13CH2][13CH2]S(=O)C |
Computed by PubChem (NCBI)