CAS 137382-41-3 is the registry number for 4-(3-Fluoro-4-methoxyphenyl)-1,2-dihydrophthalazin-1-one. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
4-(3-fluoro-4-methoxyphenyl)-2H-phthalazin-1-one (CAS 137382-41-3) is a chemical compound with the molecular formula C15H11FN2O2 and a molecular weight of 270.26 g/mol. IUPAC name: 4-(3-fluoro-4-methoxyphenyl)-2H-phthalazin-1-one. InChIKey: USBDKJZRYDSMMW-UHFFFAOYSA-N.
| Molecular formula | C15H11FN2O2 |
|---|---|
| Molecular weight | 270.26 g/mol |
| IUPAC name | 4-(3-fluoro-4-methoxyphenyl)-2H-phthalazin-1-one |
| InChIKey | USBDKJZRYDSMMW-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=NNC(=O)C3=CC=CC=C32)F |
Computed by PubChem (NCBI)