CAS 50264-63-6 appears in our catalog under these names: AB–FUBINACA metabolite 4, 1-(4-Fluorobenzyl)-1H-indazole-3-carboxylic acid. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 1 mg, 5 mg.
1-[(4-fluorophenyl)methyl]indazole-3-carboxylic acid (CAS 50264-63-6) is a chemical compound with the molecular formula C15H11FN2O2 and a molecular weight of 270.26 g/mol. IUPAC name: 1-[(4-fluorophenyl)methyl]indazole-3-carboxylic acid. InChIKey: VRKPPEZAPRSYRE-UHFFFAOYSA-N.
| Molecular formula | C15H11FN2O2 |
|---|---|
| Molecular weight | 270.26 g/mol |
| IUPAC name | 1-[(4-fluorophenyl)methyl]indazole-3-carboxylic acid |
| InChIKey | VRKPPEZAPRSYRE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NN2CC3=CC=C(C=C3)F)C(=O)O |
Computed by PubChem (NCBI)