Products 1373869-91-0

CAS 1373869-91-0 is the registry number for Pramipexole Impurity 78. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 2-[(2S)-5-cyanoimino-1-propylpyrrolidin-2-yl]acetate (CAS 1373869-91-0) is a chemical compound with the molecular formula C11H17N3O2 and a molecular weight of 223.27 g/mol. IUPAC name: methyl 2-[(2S)-5-cyanoimino-1-propylpyrrolidin-2-yl]acetate. InChIKey: PLKPHADTCIVZFV-VIFPVBQESA-N.

Identity
Molecular formulaC11H17N3O2
Molecular weight223.27 g/mol
IUPAC namemethyl 2-[(2S)-5-cyanoimino-1-propylpyrrolidin-2-yl]acetate
InChIKeyPLKPHADTCIVZFV-VIFPVBQESA-N
SMILESCCCN1[C@@H](CCC1=NC#N)CC(=O)OC

Computed by PubChem (NCBI)