CAS 1373920-97-8 appears in our catalog under these names: 6-Fluoro-3-methyl-2-(trifluoromethyl)benzaldehyde, 95%, 6-Fluoro-3-Methyl-2-(trifluoromethyl)benzaldehyde, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 25g.
6-fluoro-3-methyl-2-(trifluoromethyl)benzaldehyde (CAS 1373920-97-8) is a chemical compound with the molecular formula C9H6F4O and a molecular weight of 206.14 g/mol. IUPAC name: 6-fluoro-3-methyl-2-(trifluoromethyl)benzaldehyde. InChIKey: CLGGHNMZJHOQOY-UHFFFAOYSA-N.
| Molecular formula | C9H6F4O |
|---|---|
| Molecular weight | 206.14 g/mol |
| IUPAC name | 6-fluoro-3-methyl-2-(trifluoromethyl)benzaldehyde |
| InChIKey | CLGGHNMZJHOQOY-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)F)C=O)C(F)(F)F |
Computed by PubChem (NCBI)