CAS 845823-06-5 is the registry number for 3'-Fluoro-4'-methyl-2,2,2-trifluoroacetophenone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2,2,2-trifluoro-1-(3-fluoro-4-methylphenyl)ethanone (CAS 845823-06-5) is a chemical compound with the molecular formula C9H6F4O and a molecular weight of 206.14 g/mol. IUPAC name: 2,2,2-trifluoro-1-(3-fluoro-4-methylphenyl)ethanone. InChIKey: GMGYOGJDXAFXGX-UHFFFAOYSA-N.
| Molecular formula | C9H6F4O |
|---|---|
| Molecular weight | 206.14 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-(3-fluoro-4-methylphenyl)ethanone |
| InChIKey | GMGYOGJDXAFXGX-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)C(F)(F)F)F |
Computed by PubChem (NCBI)