Products 1374107-54-6

CAS 1374107-54-6 is the registry number for THK-5117, 98.52%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 25 mg, 50 mg, 10 mg.

Structural formula: {0} (CAS {1})

1-fluoro-3-[2-[4-(methylamino)phenyl]quinolin-6-yl]oxypropan-2-ol (CAS 1374107-54-6) is a chemical compound with the molecular formula C19H19FN2O2 and a molecular weight of 326.4 g/mol. IUPAC name: 1-fluoro-3-[2-[4-(methylamino)phenyl]quinolin-6-yl]oxypropan-2-ol. InChIKey: QXGZMQJLUUBGMN-UHFFFAOYSA-N.

Identity
Molecular formulaC19H19FN2O2
Molecular weight326.4 g/mol
IUPAC name1-fluoro-3-[2-[4-(methylamino)phenyl]quinolin-6-yl]oxypropan-2-ol
InChIKeyQXGZMQJLUUBGMN-UHFFFAOYSA-N
SMILESCNC1=CC=C(C=C1)C2=NC3=C(C=C2)C=C(C=C3)OCC(CF)O

Computed by PubChem (NCBI)