Products 1374510-74-3
CAS 1374510-74-3 appears in our catalog under these names: Methyl 4-[(e)-2-(dimethylamino)vinyl]pyrazolo[5,1-c][1,2,4]triazine-3-carboxylate, 95%, MEthyl 4-((e)-2-(dimethylamino)vinyl)pyrazolo(5,1-c)(1,2,4)triazine-3-carboxylate, 95% mix TBC as stabilizer. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
Methyl 4-[(E)-2-(dimethylamino)ethenyl]pyrazolo[5,1-c][1,2,4]triazine-3-carboxylate (CAS 1374510-74-3) is a chemical compound with the molecular formula C11H13N5O2 and a molecular weight of 247.25 g/mol. IUPAC name: methyl 4-[(E)-2-(dimethylamino)ethenyl]pyrazolo[5,1-c][1,2,4]triazine-3-carboxylate. InChIKey: KHOSXYSRZLQIJT-FNORWQNLSA-N.
| Molecular formula | C11H13N5O2 |
|---|---|
| Molecular weight | 247.25 g/mol |
| IUPAC name | methyl 4-[(E)-2-(dimethylamino)ethenyl]pyrazolo[5,1-c][1,2,4]triazine-3-carboxylate |
| InChIKey | KHOSXYSRZLQIJT-FNORWQNLSA-N |
| SMILES | CN(C)/C=C/C1=C(N=NC2=CC=NN21)C(=O)OC |
Computed by PubChem (NCBI)