Products 118353-05-2

CAS 118353-05-2 is the registry number for Carbovir. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 10mg, 1mg.

Structural formula: {0} (CAS {1})

2-amino-9-[4-(hydroxymethyl)cyclopent-2-en-1-yl]-1H-purin-6-one (CAS 118353-05-2) is a chemical compound with the molecular formula C11H13N5O2 and a molecular weight of 247.25 g/mol. IUPAC name: 2-amino-9-[4-(hydroxymethyl)cyclopent-2-en-1-yl]-1H-purin-6-one. InChIKey: XSSYCIGJYCVRRK-UHFFFAOYSA-N.

Identity
Molecular formulaC11H13N5O2
Molecular weight247.25 g/mol
IUPAC name2-amino-9-[4-(hydroxymethyl)cyclopent-2-en-1-yl]-1H-purin-6-one
InChIKeyXSSYCIGJYCVRRK-UHFFFAOYSA-N
SMILESC1C(C=CC1N2C=NC3=C2N=C(NC3=O)N)CO

Computed by PubChem (NCBI)