CAS 21612-37-3 appears in our catalog under these names: H-β-Ala-Trp-OH, beta-Alanyl-L-Tryptophan, H-beta-Ala-Trp-OH, β-Alanyl-L-Tryptophan, ≥95%, ≥95%, H-β-Ala-Trp-OH, 95%. Offered by: Creative Peptides, TRC, Biosynth, Chemat, Ambeed. Available pack sizes: on request, 50mg, 500mg, 250mg, 1000mg, 2000mg, 5000mg, 1g.
(2S)-2-(3-aminopropanoylamino)-3-(1H-indol-3-yl)propanoic acid (CAS 21612-37-3) is a chemical compound with the molecular formula C14H17N3O3 and a molecular weight of 275.30 g/mol. IUPAC name: (2S)-2-(3-aminopropanoylamino)-3-(1H-indol-3-yl)propanoic acid. InChIKey: DZBHIIZGJUBURO-LBPRGKRZSA-N.
| Molecular formula | C14H17N3O3 |
|---|---|
| Molecular weight | 275.30 g/mol |
| IUPAC name | (2S)-2-(3-aminopropanoylamino)-3-(1H-indol-3-yl)propanoic acid |
| InChIKey | DZBHIIZGJUBURO-LBPRGKRZSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C[C@@H](C(=O)O)NC(=O)CCN |
Computed by PubChem (NCBI)