Products 1374575-51-5
CAS 1374575-51-5 is the registry number for Diethyl 2-(3-methoxy-4-nitrophenyl)malonate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
Diethyl 2-(3-methoxy-4-nitrophenyl)propanedioate (CAS 1374575-51-5) is a chemical compound with the molecular formula C14H17NO7 and a molecular weight of 311.29 g/mol. IUPAC name: diethyl 2-(3-methoxy-4-nitrophenyl)propanedioate. InChIKey: HXIQFSNPKURUHI-UHFFFAOYSA-N.
| Molecular formula | C14H17NO7 |
|---|---|
| Molecular weight | 311.29 g/mol |
| IUPAC name | diethyl 2-(3-methoxy-4-nitrophenyl)propanedioate |
| InChIKey | HXIQFSNPKURUHI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C1=CC(=C(C=C1)[N+](=O)[O-])OC)C(=O)OCC |
Computed by PubChem (NCBI)