Products 156368-84-2
CAS 156368-84-2 appears in our catalog under these names: Ehretioside B, Ehretioside B. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, Get quote.
2-[4-hydroxy-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]acetonitrile (CAS 156368-84-2) is a chemical compound with the molecular formula C14H17NO7 and a molecular weight of 311.29 g/mol. IUPAC name: 2-[4-hydroxy-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]acetonitrile. InChIKey: HVSMXONXCJBJIF-RKQHYHRCSA-N.
| Molecular formula | C14H17NO7 |
|---|---|
| Molecular weight | 311.29 g/mol |
| IUPAC name | 2-[4-hydroxy-2-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]acetonitrile |
| InChIKey | HVSMXONXCJBJIF-RKQHYHRCSA-N |
| SMILES | C1=CC(=C(C=C1O)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)CC#N |
Computed by PubChem (NCBI)