CAS 1374677-45-8 is the registry number for 9–Chloro–7,7–Dimethyl–7H–Benzo(b)Fluorenone(3,4–d)Thiophene. Offered by: GLPBio. Available pack sizes: 1g, 5g.
9-chloro-7,7-dimethylfluoreno[4,3-b][1]benzothiole (CAS 1374677-45-8) is a chemical compound with the molecular formula C21H15ClS and a molecular weight of 334.9 g/mol. IUPAC name: 9-chloro-7,7-dimethylfluoreno[4,3-b][1]benzothiole. InChIKey: GZQGXRTXLXYNBJ-UHFFFAOYSA-N.
| Molecular formula | C21H15ClS |
|---|---|
| Molecular weight | 334.9 g/mol |
| IUPAC name | 9-chloro-7,7-dimethylfluoreno[4,3-b][1]benzothiole |
| InChIKey | GZQGXRTXLXYNBJ-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C3=C1C=C(C=C3)Cl)C4=C(C=C2)C5=CC=CC=C5S4)C |
Computed by PubChem (NCBI)