CAS 1616706-34-3 is the registry number for 10-Chloro-7,7-dimethyl-7H-benzo[b]fluoreno[3,4-d]thiophene, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
10-chloro-7,7-dimethylfluoreno[4,3-b][1]benzothiole (CAS 1616706-34-3) is a chemical compound with the molecular formula C21H15ClS and a molecular weight of 334.9 g/mol. IUPAC name: 10-chloro-7,7-dimethylfluoreno[4,3-b][1]benzothiole. InChIKey: IGYSXACWXPFNCW-UHFFFAOYSA-N.
| Molecular formula | C21H15ClS |
|---|---|
| Molecular weight | 334.9 g/mol |
| IUPAC name | 10-chloro-7,7-dimethylfluoreno[4,3-b][1]benzothiole |
| InChIKey | IGYSXACWXPFNCW-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=C(C=C2)Cl)C3=C1C=CC4=C3SC5=CC=CC=C45)C |
Computed by PubChem (NCBI)