CAS 1375069-14-9 appears in our catalog under these names: 3-Amino-5-bromo-N-methylbenzamide, 95%, 3-Amino-5-bromo-N-methylbenzamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 100mg.
3-amino-5-bromo-N-methylbenzamide (CAS 1375069-14-9) is a chemical compound with the molecular formula C8H9BrN2O and a molecular weight of 229.07 g/mol. IUPAC name: 3-amino-5-bromo-N-methylbenzamide. InChIKey: UTWLHIBXQJXIMG-UHFFFAOYSA-N.
| Molecular formula | C8H9BrN2O |
|---|---|
| Molecular weight | 229.07 g/mol |
| IUPAC name | 3-amino-5-bromo-N-methylbenzamide |
| InChIKey | UTWLHIBXQJXIMG-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=CC(=CC(=C1)Br)N |
Computed by PubChem (NCBI)