Products 1375097-82-7
CAS 1375097-82-7 is the registry number for 2-Chloro-5-(pyridin-2-yl)benzaldehyde. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-chloro-5-pyridin-2-ylbenzaldehyde (CAS 1375097-82-7) is a chemical compound with the molecular formula C12H8ClNO and a molecular weight of 217.65 g/mol. IUPAC name: 2-chloro-5-pyridin-2-ylbenzaldehyde. InChIKey: VQVHESZXQHXUIL-UHFFFAOYSA-N.
| Molecular formula | C12H8ClNO |
|---|---|
| Molecular weight | 217.65 g/mol |
| IUPAC name | 2-chloro-5-pyridin-2-ylbenzaldehyde |
| InChIKey | VQVHESZXQHXUIL-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=CC(=C(C=C2)Cl)C=O |
Computed by PubChem (NCBI)