CAS 1375216-20-8 appears in our catalog under these names: 1-Phenyl-3,5-bis(trifluoromethyl)-1H-pyrazole-4-carboxylic acid, 95%, 1-Phenyl-3,5-bis(trifluoromethyl)-1H-pyrazole-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
1-phenyl-3,5-bis(trifluoromethyl)pyrazole-4-carboxylic acid (CAS 1375216-20-8) is a chemical compound with the molecular formula C12H6F6N2O2 and a molecular weight of 324.18 g/mol. IUPAC name: 1-phenyl-3,5-bis(trifluoromethyl)pyrazole-4-carboxylic acid. InChIKey: KECJVGYDHQSYFK-UHFFFAOYSA-N.
| Molecular formula | C12H6F6N2O2 |
|---|---|
| Molecular weight | 324.18 g/mol |
| IUPAC name | 1-phenyl-3,5-bis(trifluoromethyl)pyrazole-4-carboxylic acid |
| InChIKey | KECJVGYDHQSYFK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=C(C(=N2)C(F)(F)F)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)