CAS 187998-46-5 is the registry number for 5–(trifluoromethyl)–1–(4–(trifluoromethyl)phenyl)–1H–pyrazole–4–carboxylic acid. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
5-(trifluoromethyl)-1-[4-(trifluoromethyl)phenyl]pyrazole-4-carboxylic acid (CAS 187998-46-5) is a chemical compound with the molecular formula C12H6F6N2O2 and a molecular weight of 324.18 g/mol. IUPAC name: 5-(trifluoromethyl)-1-[4-(trifluoromethyl)phenyl]pyrazole-4-carboxylic acid. InChIKey: ALMFCZMUUGHOGY-UHFFFAOYSA-N.
| Molecular formula | C12H6F6N2O2 |
|---|---|
| Molecular weight | 324.18 g/mol |
| IUPAC name | 5-(trifluoromethyl)-1-[4-(trifluoromethyl)phenyl]pyrazole-4-carboxylic acid |
| InChIKey | ALMFCZMUUGHOGY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(F)(F)F)N2C(=C(C=N2)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)