CAS 137528-87-1 is the registry number for 3',5'-Difluoro-4-propylbiphenyl 95%. Offered by: Ambeed. Available pack sizes: 250mg, 1g, 5g.
1,3-difluoro-5-(4-propylphenyl)benzene (CAS 137528-87-1) is a chemical compound with the molecular formula C15H14F2 and a molecular weight of 232.27 g/mol. IUPAC name: 1,3-difluoro-5-(4-propylphenyl)benzene. InChIKey: MSYHVNATNGNOOY-UHFFFAOYSA-N.
| Molecular formula | C15H14F2 |
|---|---|
| Molecular weight | 232.27 g/mol |
| IUPAC name | 1,3-difluoro-5-(4-propylphenyl)benzene |
| InChIKey | MSYHVNATNGNOOY-UHFFFAOYSA-N |
| SMILES | CCCC1=CC=C(C=C1)C2=CC(=CC(=C2)F)F |
Computed by PubChem (NCBI)