CAS 2484888-98-2 appears in our catalog under these names: 2,4-Difluoro-1-(1-(p-tolyl)ethyl)benzene, 95%, 2,4-difluoro-1-(1-(p-tolyl)ethyl)benzene, ≥95%, ≥95%, 2,4-Difluoro-1-(1-(p-tolyl)ethyl)benzene. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 250mg, 1g.
2,4-difluoro-1-[1-(4-methylphenyl)ethyl]benzene (CAS 2484888-98-2) is a chemical compound with the molecular formula C15H14F2 and a molecular weight of 232.27 g/mol. IUPAC name: 2,4-difluoro-1-[1-(4-methylphenyl)ethyl]benzene. InChIKey: QWEKPSRAEFRFMQ-UHFFFAOYSA-N.
| Molecular formula | C15H14F2 |
|---|---|
| Molecular weight | 232.27 g/mol |
| IUPAC name | 2,4-difluoro-1-[1-(4-methylphenyl)ethyl]benzene |
| InChIKey | QWEKPSRAEFRFMQ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(C)C2=C(C=C(C=C2)F)F |
Computed by PubChem (NCBI)