CAS 1375293-81-4 is the registry number for Levoglucosan-13C6. Offered by: MedChemExpress. Available pack sizes: 1 mg, 50 mg, 10 mg, 25 mg, 5 mg.
(1R,2S,3S,4R,5R)-6,8-dioxabicyclo[3.2.1]octane-2,3,4-triol (CAS 1375293-81-4) is a chemical compound with the molecular formula C6H10O5 and a molecular weight of 168.10 g/mol. IUPAC name: (1R,2S,3S,4R,5R)-6,8-dioxabicyclo[3.2.1]octane-2,3,4-triol. InChIKey: TWNIBLMWSKIRAT-NPVZAWSWSA-N.
| Molecular formula | C6H10O5 |
|---|---|
| Molecular weight | 168.10 g/mol |
| IUPAC name | (1R,2S,3S,4R,5R)-6,8-dioxabicyclo[3.2.1]octane-2,3,4-triol |
| InChIKey | TWNIBLMWSKIRAT-NPVZAWSWSA-N |
| SMILES | [13CH2]1[13C@@H]2[13C@H]([13C@@H]([13C@H]([13C@H](O1)O2)O)O)O |
Computed by PubChem (NCBI)