CAS 2483832-05-7 appears in our catalog under these names: Levoglucosan–d7, Levoglucosan-d7, 99.90%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 25 mg, 5 mg, 10 mg.
(1R,2S,3S,4R,5R)-1,2,3,4,5,7,7-heptadeuterio-6,8-dioxabicyclo[3.2.1]octane-2,3,4-triol (CAS 2483832-05-7) is a chemical compound with the molecular formula C6H10O5 and a molecular weight of 169.18 g/mol. IUPAC name: (1R,2S,3S,4R,5R)-1,2,3,4,5,7,7-heptadeuterio-6,8-dioxabicyclo[3.2.1]octane-2,3,4-triol. InChIKey: TWNIBLMWSKIRAT-JAFZBJCLSA-N.
| Molecular formula | C6H10O5 |
|---|---|
| Molecular weight | 169.18 g/mol |
| IUPAC name | (1R,2S,3S,4R,5R)-1,2,3,4,5,7,7-heptadeuterio-6,8-dioxabicyclo[3.2.1]octane-2,3,4-triol |
| InChIKey | TWNIBLMWSKIRAT-JAFZBJCLSA-N |
| SMILES | [2H][C@@]1([C@]([C@]2(C(O[C@@]([C@]1([2H])O)(O2)[2H])([2H])[2H])[2H])([2H])O)O |
Computed by PubChem (NCBI)