Products 1375303-30-2

CAS 1375303-30-2 is the registry number for (6-(Aminomethyl)pyridin-3-yl)boronic acid hydrochloride, 98% (dihydrochloride). Offered by: Ambeed. Available pack sizes: 100mg, 1g, 250mg.

Structural formula: {0} (CAS {1})

[6-(aminomethyl)-3-pyridinyl]boronic acid;hydrochloride (CAS 1375303-30-2) is a chemical compound with the molecular formula C6H10BClN2O2 and a molecular weight of 188.42 g/mol. IUPAC name: [6-(aminomethyl)-3-pyridinyl]boronic acid;hydrochloride. InChIKey: VXTYLOJPTHZTKT-UHFFFAOYSA-N.

Identity
Molecular formulaC6H10BClN2O2
Molecular weight188.42 g/mol
IUPAC name[6-(aminomethyl)-3-pyridinyl]boronic acid;hydrochloride
InChIKeyVXTYLOJPTHZTKT-UHFFFAOYSA-N
SMILESB(C1=CN=C(C=C1)CN)(O)O.Cl

Computed by PubChem (NCBI)