CAS 1375303-30-2 is the registry number for (6-(Aminomethyl)pyridin-3-yl)boronic acid hydrochloride, 98% (dihydrochloride). Offered by: Ambeed. Available pack sizes: 100mg, 1g, 250mg.
[6-(aminomethyl)-3-pyridinyl]boronic acid;hydrochloride (CAS 1375303-30-2) is a chemical compound with the molecular formula C6H10BClN2O2 and a molecular weight of 188.42 g/mol. IUPAC name: [6-(aminomethyl)-3-pyridinyl]boronic acid;hydrochloride. InChIKey: VXTYLOJPTHZTKT-UHFFFAOYSA-N.
| Molecular formula | C6H10BClN2O2 |
|---|---|
| Molecular weight | 188.42 g/mol |
| IUPAC name | [6-(aminomethyl)-3-pyridinyl]boronic acid;hydrochloride |
| InChIKey | VXTYLOJPTHZTKT-UHFFFAOYSA-N |
| SMILES | B(C1=CN=C(C=C1)CN)(O)O.Cl |
Computed by PubChem (NCBI)