Products 2304635-84-3

CAS 2304635-84-3 is the registry number for 6-Amino-5-methylpyridin-3-ylboronic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

(6-amino-5-methyl-3-pyridinyl)boronic acid;hydrochloride (CAS 2304635-84-3) is a chemical compound with the molecular formula C6H10BClN2O2 and a molecular weight of 188.42 g/mol. IUPAC name: (6-amino-5-methyl-3-pyridinyl)boronic acid;hydrochloride. InChIKey: NRZOWUVITBWCSV-UHFFFAOYSA-N.

Identity
Molecular formulaC6H10BClN2O2
Molecular weight188.42 g/mol
IUPAC name(6-amino-5-methyl-3-pyridinyl)boronic acid;hydrochloride
InChIKeyNRZOWUVITBWCSV-UHFFFAOYSA-N
SMILESB(C1=CC(=C(N=C1)N)C)(O)O.Cl

Computed by PubChem (NCBI)