CAS 1375472-12-0 appears in our catalog under these names: 2-Amino-N-(2H-indazol-6-yl)acetamide dihydrochloride, 95%, 2-Amino-N-(2H-indazol-6-yl)acetamide dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-amino-N-(1H-indazol-6-yl)acetamide;dihydrochloride (CAS 1375472-12-0) is a chemical compound with the molecular formula C9H12Cl2N4O and a molecular weight of 263.12 g/mol. IUPAC name: 2-amino-N-(1H-indazol-6-yl)acetamide;dihydrochloride. InChIKey: FZLJASUUEXCKNS-UHFFFAOYSA-N.
| Molecular formula | C9H12Cl2N4O |
|---|---|
| Molecular weight | 263.12 g/mol |
| IUPAC name | 2-amino-N-(1H-indazol-6-yl)acetamide;dihydrochloride |
| InChIKey | FZLJASUUEXCKNS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1NC(=O)CN)NN=C2.Cl.Cl |
Computed by PubChem (NCBI)