CAS 1435804-37-7 is the registry number for 2-(3-(Pyridin-3-yl)-1,2,4-oxadiazol-5-yl)ethan-1-amine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.
2-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)ethanamine;dihydrochloride (CAS 1435804-37-7) is a chemical compound with the molecular formula C9H12Cl2N4O and a molecular weight of 263.12 g/mol. IUPAC name: 2-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)ethanamine;dihydrochloride. InChIKey: ZGOIGYILUTUTBN-UHFFFAOYSA-N.
| Molecular formula | C9H12Cl2N4O |
|---|---|
| Molecular weight | 263.12 g/mol |
| IUPAC name | 2-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)ethanamine;dihydrochloride |
| InChIKey | ZGOIGYILUTUTBN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C2=NOC(=N2)CCN.Cl.Cl |
Computed by PubChem (NCBI)