Products 1375473-28-1

CAS 1375473-28-1 is the registry number for 2-Hydroxy-2-methyl-3-phenylbutanoic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

2-hydroxy-2-methyl-3-phenylbutanoic acid (CAS 1375473-28-1) is a chemical compound with the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. IUPAC name: 2-hydroxy-2-methyl-3-phenylbutanoic acid. InChIKey: VHLFCAAQEUXARG-UHFFFAOYSA-N.

Identity
Molecular formulaC11H14O3
Molecular weight194.23 g/mol
IUPAC name2-hydroxy-2-methyl-3-phenylbutanoic acid
InChIKeyVHLFCAAQEUXARG-UHFFFAOYSA-N
SMILESCC(C1=CC=CC=C1)C(C)(C(=O)O)O

Computed by PubChem (NCBI)