Products 1375476-93-9
CAS 1375476-93-9 is the registry number for N-((1-Benzyl-3,5-dimethyl-1H-pyrazol-4-yl)methylidene)hydroxylamine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(NE)-N-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methylidene]hydroxylamine (CAS 1375476-93-9) is a chemical compound with the molecular formula C13H15N3O and a molecular weight of 229.28 g/mol. IUPAC name: (NE)-N-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methylidene]hydroxylamine. InChIKey: PGJINSLINBVDJQ-RIYZIHGNSA-N.
| Molecular formula | C13H15N3O |
|---|---|
| Molecular weight | 229.28 g/mol |
| IUPAC name | (NE)-N-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methylidene]hydroxylamine |
| InChIKey | PGJINSLINBVDJQ-RIYZIHGNSA-N |
| SMILES | CC1=C(C(=NN1CC2=CC=CC=C2)C)/C=N/O |
Computed by PubChem (NCBI)