Products 1375603-36-3
CAS 1375603-36-3 appears in our catalog under these names: Seviteronel (racemate), 98.11%, VT-464 racemate, 98.11%. Offered by: MedChemExpress, Chemat. Available pack sizes: 50 mg, 10mM/1mL, 25 mg, 10 mg, 100 mg, 5 mg, 2mg.
1-[6,7-bis(difluoromethoxy)naphthalen-2-yl]-2-methyl-1-(2H-triazol-4-yl)propan-1-ol (CAS 1375603-36-3) is a chemical compound with the molecular formula C18H17F4N3O3 and a molecular weight of 399.3 g/mol. IUPAC name: 1-[6,7-bis(difluoromethoxy)naphthalen-2-yl]-2-methyl-1-(2H-triazol-4-yl)propan-1-ol. InChIKey: ZBRAJOQFSNYJMF-UHFFFAOYSA-N.
| Molecular formula | C18H17F4N3O3 |
|---|---|
| Molecular weight | 399.3 g/mol |
| IUPAC name | 1-[6,7-bis(difluoromethoxy)naphthalen-2-yl]-2-methyl-1-(2H-triazol-4-yl)propan-1-ol |
| InChIKey | ZBRAJOQFSNYJMF-UHFFFAOYSA-N |
| SMILES | CC(C)C(C1=CC2=CC(=C(C=C2C=C1)OC(F)F)OC(F)F)(C3=NNN=C3)O |
Computed by PubChem (NCBI)