CAS 1375603-38-5 appears in our catalog under these names: Seviteronel R enantiomer/ 99.98% (existing batch purity), Seviteronel (R enantiomer), Seviteronel (R enantiomer), 98.82%. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10 mg, 100 mg.
(1R)-1-[6,7-bis(difluoromethoxy)naphthalen-2-yl]-2-methyl-1-(2H-triazol-4-yl)propan-1-ol (CAS 1375603-38-5) is a chemical compound with the molecular formula C18H17F4N3O3 and a molecular weight of 399.3 g/mol. IUPAC name: (1R)-1-[6,7-bis(difluoromethoxy)naphthalen-2-yl]-2-methyl-1-(2H-triazol-4-yl)propan-1-ol. InChIKey: ZBRAJOQFSNYJMF-GOSISDBHSA-N.
| Molecular formula | C18H17F4N3O3 |
|---|---|
| Molecular weight | 399.3 g/mol |
| IUPAC name | (1R)-1-[6,7-bis(difluoromethoxy)naphthalen-2-yl]-2-methyl-1-(2H-triazol-4-yl)propan-1-ol |
| InChIKey | ZBRAJOQFSNYJMF-GOSISDBHSA-N |
| SMILES | CC(C)[C@@](C1=CC2=CC(=C(C=C2C=C1)OC(F)F)OC(F)F)(C3=NNN=C3)O |
Computed by PubChem (NCBI)