CAS 1375746-94-3 is the registry number for Rel-(1s,3s)-3-((tert-butyldimethylsilyl)oxy)-3-methylcyclobutane-1-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[tert-butyl(dimethyl)silyl]oxy-3-methylcyclobutane-1-carboxylic acid (CAS 1375746-94-3) is a chemical compound with the molecular formula C12H24O3Si and a molecular weight of 244.40 g/mol. IUPAC name: 3-[tert-butyl(dimethyl)silyl]oxy-3-methylcyclobutane-1-carboxylic acid. InChIKey: SGKHACSKXNWDGI-UHFFFAOYSA-N.
| Molecular formula | C12H24O3Si |
|---|---|
| Molecular weight | 244.40 g/mol |
| IUPAC name | 3-[tert-butyl(dimethyl)silyl]oxy-3-methylcyclobutane-1-carboxylic acid |
| InChIKey | SGKHACSKXNWDGI-UHFFFAOYSA-N |
| SMILES | CC1(CC(C1)C(=O)O)O[Si](C)(C)C(C)(C)C |
Computed by PubChem (NCBI)