CAS 2095410-41-4 is the registry number for 2-{3-((tert-Butyldimethylsilyl)oxy)oxolan-3-yl}acetaldehyde. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-[3-[tert-butyl(dimethyl)silyl]oxyoxolan-3-yl]acetaldehyde (CAS 2095410-41-4) is a chemical compound with the molecular formula C12H24O3Si and a molecular weight of 244.40 g/mol. IUPAC name: 2-[3-[tert-butyl(dimethyl)silyl]oxyoxolan-3-yl]acetaldehyde. InChIKey: BHGUYRWRYLHADF-UHFFFAOYSA-N.
| Molecular formula | C12H24O3Si |
|---|---|
| Molecular weight | 244.40 g/mol |
| IUPAC name | 2-[3-[tert-butyl(dimethyl)silyl]oxyoxolan-3-yl]acetaldehyde |
| InChIKey | BHGUYRWRYLHADF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC1(CCOC1)CC=O |
Computed by PubChem (NCBI)